C34H48O4S — CID 169016936
3-(2-ethylhexoxy)-4-hexoxy-2-[4-methoxy-3-(2-methoxy-5-methylphenyl)phenyl]-5-methylthiophene (PubChem CID 169016936) has the molecular formula C34H48O4S and a molecular weight of 552.82 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)-4-hexoxy-2-[4-methoxy-3-(2-methoxy-5-methylphenyl)phenyl]-5-methylthiophene.
| Compound Name | 3-(2-ethylhexoxy)-4-hexoxy-2-[4-methoxy-3-(2-methoxy-5-methylphenyl)phenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 169016936 |
| Molecular Formula | C34H48O4S |
| Molecular Weight | 552.82 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | 3-(2-ethylhexoxy)-4-hexoxy-2-[4-methoxy-3-(2-methoxy-5-methylphenyl)phenyl]-5-methylthiophene |
| SMILES | CCCCCCOc1c(C)sc(-c2ccc(OC)c(-c3cc(C)ccc3OC)c2)c1OCC(CC)CCCC |
| InChI | InChI=1S/C34H48O4S/c1-8-11-13-14-20-37-32-25(5)39-34(33(32)38-23-26(10-3)15-12-9-2)27-17-19-31(36-7)29(22-27)28-21-24(4)16-18-30(28)35-6/h16-19,21-22,26H,8-15,20,23H2,1-7H3 |
| InChIKey | XJYWTWPSMYALNH-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.82 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|