C16H9F7 — CID 169049974
1-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)-2-methylnaphthalene (PubChem CID 169049974) has the molecular formula C16H9F7 and a molecular weight of 334.23 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)-2-methylnaphthalene.
| Compound Name | 1-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)-2-methylnaphthalene |
|---|---|
| PubChem CID | 169049974 |
| Molecular Formula | C16H9F7 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)-2-methylnaphthalene |
| SMILES | Cc1ccc2ccccc2c1C#CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H9F7/c1-10-6-7-11-4-2-3-5-13(11)12(10)8-9-14(17,18)15(19,20)16(21,22)23/h2-7H,1H3 |
| InChIKey | KIBDPASDBCDGIW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|