C47H40N2 — CID 169071805
1-[[2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]ethyl]phenyl]methyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole (PubChem CID 169071805) has the molecular formula C47H40N2 and a molecular weight of 645.93 g/mol. Its IUPAC name is 1-[[2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]ethyl]phenyl]methyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole.
| Compound Name | 1-[[2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]ethyl]phenyl]methyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
|---|---|
| PubChem CID | 169071805 |
| Molecular Formula | C47H40N2 |
| Molecular Weight | 645.93 g/mol |
| Exact Mass | 645.40 |
| IUPAC Name | 1-[[2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]ethyl]phenyl]methyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c([2H])c([2H])c([2H])c([2H])c3c(CCc3ccccc3Cn3c(C([2H])([2H])C([2H])([2H])[2H])nc4ccccc43)c2c1[2H] |
| InChI | InChI=1S/C47H40N2/c1-4-45-48-43-23-13-14-24-44(43)49(45)30-33-16-6-5-15-31(33)25-27-36-34-17-7-9-20-39(34)46(40-21-10-8-18-35(36)40)32-26-28-38-37-19-11-12-22-41(37)47(2,3)42(38)29-32/h5-24,26,28-29H,4,25,27,30H2,1-3H3/i1D3,4D2,7D,8D,9D,10D,17D,18D,20D,21D |
| InChIKey | BVMZCGFQEQUEJQ-BSOJACHYSA-N |
| XLogP | 11.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.93 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|