C22H15NO7 — CID 169073258
2-[4-(aminomethyl)-3-hydroxy-6-oxoxanthen-9-yl]-4-formyloxybenzoic acid (PubChem CID 169073258) has the molecular formula C22H15NO7 and a molecular weight of 405.36 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-3-hydroxy-6-oxoxanthen-9-yl]-4-formyloxybenzoic acid.
| Compound Name | 2-[4-(aminomethyl)-3-hydroxy-6-oxoxanthen-9-yl]-4-formyloxybenzoic acid |
|---|---|
| PubChem CID | 169073258 |
| Molecular Formula | C22H15NO7 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[4-(aminomethyl)-3-hydroxy-6-oxoxanthen-9-yl]-4-formyloxybenzoic acid |
| SMILES | NCc1c(O)ccc2c(-c3cc(OC=O)ccc3C(=O)O)c3ccc(=O)cc-3oc12 |
| InChI | InChI=1S/C22H15NO7/c23-9-17-18(26)6-5-15-20(14-3-1-11(25)7-19(14)30-21(15)17)16-8-12(29-10-24)2-4-13(16)22(27)28/h1-8,10,26H,9,23H2,(H,27,28) |
| InChIKey | ZKFGMXDIFQIKHC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|