C15H22O3 — CID 169074622
(3R,4E,6E,10S,12Z)-pentadeca-4,6,12-trien-8-yne-1,3,10-triol (PubChem CID 169074622) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,4E,6E,10S,12Z)-pentadeca-4,6,12-trien-8-yne-1,3,10-triol.
| Compound Name | (3R,4E,6E,10S,12Z)-pentadeca-4,6,12-trien-8-yne-1,3,10-triol |
|---|---|
| PubChem CID | 169074622 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R,4E,6E,10S,12Z)-pentadeca-4,6,12-trien-8-yne-1,3,10-triol |
| SMILES | CC/C=C\C[C@H](O)C#C/C=C/C=C/[C@H](O)CCO |
| InChI | InChI=1S/C15H22O3/c1-2-3-6-9-14(17)10-7-4-5-8-11-15(18)12-13-16/h3-6,8,11,14-18H,2,9,12-13H2,1H3/b5-4+,6-3-,11-8+/t14-,15-/m0/s1 |
| InChIKey | JUCMBVOULYEJQP-LDGUSDAFSA-N |
| XLogP | 1.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|