C17H28O — CID 170250035
(3S,4E,6E,8E,10S,12Z)-3,10-dimethylpentadeca-4,6,8,12-tetraen-1-ol (PubChem CID 170250035) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (3S,4E,6E,8E,10S,12Z)-3,10-dimethylpentadeca-4,6,8,12-tetraen-1-ol.
| Compound Name | (3S,4E,6E,8E,10S,12Z)-3,10-dimethylpentadeca-4,6,8,12-tetraen-1-ol |
|---|---|
| PubChem CID | 170250035 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (3S,4E,6E,8E,10S,12Z)-3,10-dimethylpentadeca-4,6,8,12-tetraen-1-ol |
| SMILES | CC/C=C\C[C@H](C)/C=C/C=C/C=C/[C@@H](C)CCO |
| InChI | InChI=1S/C17H28O/c1-4-5-8-11-16(2)12-9-6-7-10-13-17(3)14-15-18/h5-10,12-13,16-18H,4,11,14-15H2,1-3H3/b7-6+,8-5-,12-9+,13-10+/t16-,17+/m0/s1 |
| InChIKey | RPEPNXVWJGGTRS-YYRPMZFFSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|