C30H32O7 — CID 169084562
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,4,8,10-tetrahydroxy-11-(3-methylbut-2-enyl)-5H-isochromeno[4,3-b]chromen-7-one (PubChem CID 169084562) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,4,8,10-tetrahydroxy-11-(3-methylbut-2-enyl)-5H-isochromeno[4,3-b]chromen-7-one.
| Compound Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,4,8,10-tetrahydroxy-11-(3-methylbut-2-enyl)-5H-isochromeno[4,3-b]chromen-7-one |
|---|---|
| PubChem CID | 169084562 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,4,8,10-tetrahydroxy-11-(3-methylbut-2-enyl)-5H-isochromeno[4,3-b]chromen-7-one |
| SMILES | CC(C)=CCC/C(C)=C/C1Oc2c(oc3c(CC=C(C)C)c(O)cc(O)c3c2=O)-c2ccc(O)c(O)c21 |
| InChI | InChI=1S/C30H32O7/c1-15(2)7-6-8-17(5)13-23-24-19(11-12-20(31)26(24)34)29-30(36-23)27(35)25-22(33)14-21(32)18(28(25)37-29)10-9-16(3)4/h7,9,11-14,23,31-34H,6,8,10H2,1-5H3/b17-13+ |
| InChIKey | MWIJOKQMICIUAH-GHRIWEEISA-N |
| XLogP | 6.92 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|