C12H12BrNO2S2 — CID 169086167
2-[(Z)-2-bromo-2-(4-nitrophenyl)ethenyl]-1,3-dithiane (PubChem CID 169086167) has the molecular formula C12H12BrNO2S2 and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-[(Z)-2-bromo-2-(4-nitrophenyl)ethenyl]-1,3-dithiane.
| Compound Name | 2-[(Z)-2-bromo-2-(4-nitrophenyl)ethenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 169086167 |
| Molecular Formula | C12H12BrNO2S2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2-[(Z)-2-bromo-2-(4-nitrophenyl)ethenyl]-1,3-dithiane |
| SMILES | O=[N+]([O-])c1ccc(/C(Br)=C/C2SCCCS2)cc1 |
| InChI | InChI=1S/C12H12BrNO2S2/c13-11(8-12-17-6-1-7-18-12)9-2-4-10(5-3-9)14(15)16/h2-5,8,12H,1,6-7H2/b11-8- |
| InChIKey | HHIXMTHKTVXRPG-FLIBITNWSA-N |
| XLogP | 4.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|