C14H20Cl2N12O — CID 169095100
2-N-(3-azidopropyl)-6-chloro-4-N-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4-diamine (PubChem CID 169095100) has the molecular formula C14H20Cl2N12O and a molecular weight of 443.30 g/mol. Its IUPAC name is 2-N-(3-azidopropyl)-6-chloro-4-N-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-azidopropyl)-6-chloro-4-N-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 169095100 |
| Molecular Formula | C14H20Cl2N12O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-N-(3-azidopropyl)-6-chloro-4-N-[4-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(Cl)nc(NCCCCNc2nc(Cl)nc(NCCCN=[N+]=[N-])n2)n1 |
| InChI | InChI=1S/C14H20Cl2N12O/c1-29-14-25-10(16)24-13(27-14)19-6-3-2-5-18-11-22-9(15)23-12(26-11)20-7-4-8-21-28-17/h2-8H2,1H3,(H,19,24,25,27)(H2,18,20,22,23,26) |
| InChIKey | AJOAFUFEVSSUHP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|