C35H58O2 — CID 169097579
(2S)-2,5,7,8-tetramethyl-3,3-bis(prop-2-enyl)-2-[(4R,8S)-4,8,12-trimethyltridecyl]-4H-chromen-6-ol (PubChem CID 169097579) has the molecular formula C35H58O2 and a molecular weight of 510.85 g/mol. Its IUPAC name is (2S)-2,5,7,8-tetramethyl-3,3-bis(prop-2-enyl)-2-[(4R,8S)-4,8,12-trimethyltridecyl]-4H-chromen-6-ol.
| Compound Name | (2S)-2,5,7,8-tetramethyl-3,3-bis(prop-2-enyl)-2-[(4R,8S)-4,8,12-trimethyltridecyl]-4H-chromen-6-ol |
|---|---|
| PubChem CID | 169097579 |
| Molecular Formula | C35H58O2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | (2S)-2,5,7,8-tetramethyl-3,3-bis(prop-2-enyl)-2-[(4R,8S)-4,8,12-trimethyltridecyl]-4H-chromen-6-ol |
| SMILES | C=CCC1(CC=C)Cc2c(C)c(O)c(C)c(C)c2O[C@@]1(C)CCC[C@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C35H58O2/c1-11-21-35(22-12-2)24-31-30(9)32(36)28(7)29(8)33(31)37-34(35,10)23-15-20-27(6)19-14-18-26(5)17-13-16-25(3)4/h11-12,25-27,36H,1-2,13-24H2,3-10H3/t26-,27+,34-/m0/s1 |
| InChIKey | BDFVHRAPMSUDPG-MZXMJASYSA-N |
| XLogP | 10.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|