C22H27ClN8O2S — CID 169110106
3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(3-hydroxypropyl)-1,3-thiazol-2-yl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 169110106) has the molecular formula C22H27ClN8O2S and a molecular weight of 503.03 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(3-hydroxypropyl)-1,3-thiazol-2-yl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(3-hydroxypropyl)-1,3-thiazol-2-yl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169110106 |
| Molecular Formula | C22H27ClN8O2S |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-(3-hydroxypropyl)-1,3-thiazol-2-yl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(-c2ncc(CCCO)s2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C22H27ClN8O2S/c23-17-19(25)30-18(24)16(29-17)20(33)31-22(26)27-10-2-1-4-13-6-8-14(9-7-13)21-28-12-15(34-21)5-3-11-32/h6-9,12,32H,1-5,10-11H2,(H4,24,25,30)(H3,26,27,31,33) |
| InChIKey | NTIBOSQCFMHTTF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|