C32H35ClF2N4O3 — CID 169126226
3-[7-(3-chloro-2-cyclopropyl-5-hydroxyphenyl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol (PubChem CID 169126226) has the molecular formula C32H35ClF2N4O3 and a molecular weight of 597.11 g/mol. Its IUPAC name is 3-[7-(3-chloro-2-cyclopropyl-5-hydroxyphenyl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol.
| Compound Name | 3-[7-(3-chloro-2-cyclopropyl-5-hydroxyphenyl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 169126226 |
| Molecular Formula | C32H35ClF2N4O3 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 3-[7-(3-chloro-2-cyclopropyl-5-hydroxyphenyl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-azabicyclo[3.2.1]octan-6-ol |
| SMILES | Oc1cc(Cl)c(C2CC2)c(-c2c(F)cc3c(N4CC5CC(O)C(C5)C4)nc(OCC45CCCN4CCC5)nc3c2F)c1 |
| InChI | InChI=1S/C32H35ClF2N4O3/c33-23-12-20(40)11-21(26(23)18-3-4-18)27-24(34)13-22-29(28(27)35)36-31(42-16-32-5-1-7-39(32)8-2-6-32)37-30(22)38-14-17-9-19(15-38)25(41)10-17/h11-13,17-19,25,40-41H,1-10,14-16H2 |
| InChIKey | BTCZTPZXRMPWTH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |