C10H20N+ — CID 169132162
4,4-diethyl-1-methyl-3,5-dihydro-2H-pyridin-1-ium (PubChem CID 169132162) has the molecular formula C10H20N+ and a molecular weight of 154.28 g/mol. Its IUPAC name is 4,4-diethyl-1-methyl-3,5-dihydro-2H-pyridin-1-ium.
| Compound Name | 4,4-diethyl-1-methyl-3,5-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 169132162 |
| Molecular Formula | C10H20N+ |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.16 |
| IUPAC Name | 4,4-diethyl-1-methyl-3,5-dihydro-2H-pyridin-1-ium |
| SMILES | CCC1(CC)CC=[N+](C)CC1 |
| InChI | InChI=1S/C10H20N/c1-4-10(5-2)6-8-11(3)9-7-10/h8H,4-7,9H2,1-3H3/q+1 |
| InChIKey | JUDPADJZUHFDJQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|