C28H31N5O4 — CID 169132935
tert-butyl 6-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethylamino]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 169132935) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is tert-butyl 6-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethylamino]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 6-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethylamino]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 169132935 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl 6-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethylamino]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C2NCCO/N=C1/C(c2c(O)[nH]c3ccccc23)=Nc2ccccc21 |
| InChI | InChI=1S/C28H31N5O4/c1-28(2,3)37-27(35)33-14-18-19(15-33)23(18)29-12-13-36-32-24-17-9-5-7-11-21(17)30-25(24)22-16-8-4-6-10-20(16)31-26(22)34/h4-11,18-19,23,29,31,34H,12-15H2,1-3H3/b32-24+ |
| InChIKey | OJOMQKWJQKWMCN-FEZSWGLMSA-N |
| XLogP | 4.18 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|