C36H34FN3O3S — CID 169135576
N-[2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]ethyl]prop-2-enamide (PubChem CID 169135576) has the molecular formula C36H34FN3O3S and a molecular weight of 607.75 g/mol. Its IUPAC name is N-[2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135576 |
| Molecular Formula | C36H34FN3O3S |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | N-[2-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1cccc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C36H34FN3O3S/c1-3-32(41)39-15-11-23-5-4-6-25(19-23)35-33(29-10-9-28(37)21-31(29)43-17-16-42-2)36-30(13-18-44-36)34(40-35)26-7-8-27-22-38-14-12-24(27)20-26/h3-10,13,18-21,38H,1,11-12,14-17,22H2,2H3,(H,39,41) |
| InChIKey | PEHPJQCDAVFBDI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|