C37H38FN3O3S — CID 169136085
N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-2,2-dimethylpropanamide (PubChem CID 169136085) has the molecular formula C37H38FN3O3S and a molecular weight of 623.79 g/mol. Its IUPAC name is N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 169136085 |
| Molecular Formula | C37H38FN3O3S |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-2,2-dimethylpropanamide |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2cccc(CNC(=O)C(C)(C)C)c2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C37H38FN3O3S/c1-37(2,3)36(42)40-21-23-6-5-7-25(18-23)34-32(29-11-10-28(38)20-31(29)44-16-15-43-4)35-30(13-17-45-35)33(41-34)26-8-9-27-22-39-14-12-24(27)19-26/h5-11,13,17-20,39H,12,14-16,21-22H2,1-4H3,(H,40,42) |
| InChIKey | KMBHUVVXMPTVJL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|