C21H42N2O5 — CID 169158456
N-(3-formylcyclobutyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]propanamide;2-methylpropanal;2-methylpropane (PubChem CID 169158456) has the molecular formula C21H42N2O5 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-(3-formylcyclobutyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]propanamide;2-methylpropanal;2-methylpropane.
| Compound Name | N-(3-formylcyclobutyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]propanamide;2-methylpropanal;2-methylpropane |
|---|---|
| PubChem CID | 169158456 |
| Molecular Formula | C21H42N2O5 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | N-(3-formylcyclobutyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]propanamide;2-methylpropanal;2-methylpropane |
| SMILES | CC(C)C.CC(C)C=O.CNCCOCCOCCC(=O)NC1CC(C=O)C1 |
| InChI | InChI=1S/C13H24N2O4.C4H8O.C4H10/c1-14-3-5-19-7-6-18-4-2-13(17)15-12-8-11(9-12)10-16;1-4(2)3-5;1-4(2)3/h10-12,14H,2-9H2,1H3,(H,15,17);3-4H,1-2H3;4H,1-3H3 |
| InChIKey | SUUCGRQCSAZRDV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|