C18H21FNO4P — CID 169170523
[(7-carbamoylnaphthalen-2-yl)-fluoromethyl]phosphanyloxymethyl 2,2-dimethylpropanoate (PubChem CID 169170523) has the molecular formula C18H21FNO4P and a molecular weight of 365.34 g/mol. Its IUPAC name is [(7-carbamoylnaphthalen-2-yl)-fluoromethyl]phosphanyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(7-carbamoylnaphthalen-2-yl)-fluoromethyl]phosphanyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 169170523 |
| Molecular Formula | C18H21FNO4P |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [(7-carbamoylnaphthalen-2-yl)-fluoromethyl]phosphanyloxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOPC(F)c1ccc2ccc(C(N)=O)cc2c1 |
| InChI | InChI=1S/C18H21FNO4P/c1-18(2,3)17(22)23-10-24-25-15(19)12-6-4-11-5-7-13(16(20)21)9-14(11)8-12/h4-9,15,25H,10H2,1-3H3,(H2,20,21) |
| InChIKey | BOUAOSHPYDRTIN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|