C46H83N5O5S — CID 169173317
2-[[2-[[4-amino-5-[2-[bis[(8E,11E)-heptadeca-8,11-dienyl]amino]ethylamino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 169173317) has the molecular formula C46H83N5O5S and a molecular weight of 818.27 g/mol. Its IUPAC name is 2-[[2-[[4-amino-5-[2-[bis[(8E,11E)-heptadeca-8,11-dienyl]amino]ethylamino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[4-amino-5-[2-[bis[(8E,11E)-heptadeca-8,11-dienyl]amino]ethylamino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 169173317 |
| Molecular Formula | C46H83N5O5S |
| Molecular Weight | 818.27 g/mol |
| Exact Mass | 817.61 |
| IUPAC Name | 2-[[2-[[4-amino-5-[2-[bis[(8E,11E)-heptadeca-8,11-dienyl]amino]ethylamino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCN(CCCCCCC/C=C/C/C=C/CCCCC)CCNC(=O)C(N)CCC(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C46H83N5O5S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-51(37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)38-35-48-45(55)41(47)33-34-43(52)50-42(40-57)46(56)49-39-44(53)54/h11-14,17-20,41-42,57H,3-10,15-16,21-40,47H2,1-2H3,(H,48,55)(H,49,56)(H,50,52)(H,53,54)/b13-11+,14-12+,19-17+,20-18+ |
| InChIKey | DSJILTKDJLWLRZ-WVZYQCMWSA-N |
| XLogP | 8.97 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.27 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|