C19H25NOS — CID 169195900
methylidene-(4-methylphenyl)-oxo-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)-λ6-sulfane (PubChem CID 169195900) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is methylidene-(4-methylphenyl)-oxo-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)-λ6-sulfane.
| Compound Name | methylidene-(4-methylphenyl)-oxo-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)-λ6-sulfane |
|---|---|
| PubChem CID | 169195900 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methylidene-(4-methylphenyl)-oxo-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)-λ6-sulfane |
| SMILES | C=S(=O)(c1ccc(C)cc1)n1cc(C)c2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C19H25NOS/c1-14-6-8-16(9-7-14)22(5,21)20-13-15(2)17-10-11-19(3,4)12-18(17)20/h6-9,13H,5,10-12H2,1-4H3 |
| InChIKey | WKFUUVSMQKJNQD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|