C20H23N3O4 — CID 169201293
3-(3'-methyl-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl)piperidine-2,6-dione (PubChem CID 169201293) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(3'-methyl-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl)piperidine-2,6-dione.
| Compound Name | 3-(3'-methyl-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201293 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(3'-methyl-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl)piperidine-2,6-dione |
| SMILES | CC1CNCCC12COc1c2ccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H23N3O4/c1-11-8-21-7-6-20(11)10-27-17-13-9-23(15-4-5-16(24)22-18(15)25)19(26)12(13)2-3-14(17)20/h2-3,11,15,21H,4-10H2,1H3,(H,22,24,25) |
| InChIKey | OBDPTQMBRUOAFT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|