C12H16O5 — CID 169212986
[2-acetyloxy-2-(cyclopropylidenemethyl)oxolan-3-yl] acetate (PubChem CID 169212986) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [2-acetyloxy-2-(cyclopropylidenemethyl)oxolan-3-yl] acetate.
| Compound Name | [2-acetyloxy-2-(cyclopropylidenemethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 169212986 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [2-acetyloxy-2-(cyclopropylidenemethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1CCOC1(C=C1CC1)OC(C)=O |
| InChI | InChI=1S/C12H16O5/c1-8(13)16-11-5-6-15-12(11,17-9(2)14)7-10-3-4-10/h7,11H,3-6H2,1-2H3 |
| InChIKey | PLOWKUOLMWCJKB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|