C34H35Cl2FO3 — CID 169239105
6-(2,4-dichlorophenyl)-5-[4-[(1S)-3-(5-fluoropentyl)cyclopentyl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 169239105) has the molecular formula C34H35Cl2FO3 and a molecular weight of 581.56 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-5-[4-[(1S)-3-(5-fluoropentyl)cyclopentyl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 6-(2,4-dichlorophenyl)-5-[4-[(1S)-3-(5-fluoropentyl)cyclopentyl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 169239105 |
| Molecular Formula | C34H35Cl2FO3 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-5-[4-[(1S)-3-(5-fluoropentyl)cyclopentyl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(O[C@H]2CCC(CCCCCF)C2)cc1 |
| InChI | InChI=1S/C34H35Cl2FO3/c35-26-12-17-30(32(36)21-26)31-7-4-6-24-20-25(34(38)39)11-16-29(24)33(31)23-9-14-27(15-10-23)40-28-13-8-22(19-28)5-2-1-3-18-37/h9-12,14-17,20-22,28H,1-8,13,18-19H2,(H,38,39)/t22?,28-/m0/s1 |
| InChIKey | JHUSUVVENCCWJB-WNWQKLGWSA-N |
| XLogP | 10.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|