C32H32Cl3FNO3+ — CID 170168601
5-[4-[(3S)-1-(chloromethyl)-1-(3-fluoropropyl)pyrrolidin-1-ium-3-yl]oxyphenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 170168601) has the molecular formula C32H32Cl3FNO3+ and a molecular weight of 603.97 g/mol. Its IUPAC name is 5-[4-[(3S)-1-(chloromethyl)-1-(3-fluoropropyl)pyrrolidin-1-ium-3-yl]oxyphenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 5-[4-[(3S)-1-(chloromethyl)-1-(3-fluoropropyl)pyrrolidin-1-ium-3-yl]oxyphenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 170168601 |
| Molecular Formula | C32H32Cl3FNO3+ |
| Molecular Weight | 603.97 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 5-[4-[(3S)-1-(chloromethyl)-1-(3-fluoropropyl)pyrrolidin-1-ium-3-yl]oxyphenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(O[C@H]2CC[N+](CCl)(CCCF)C2)cc1 |
| InChI | InChI=1S/C32H31Cl3FNO3/c33-20-37(15-2-14-36)16-13-26(19-37)40-25-9-5-21(6-10-25)31-27-11-7-23(32(38)39)17-22(27)3-1-4-29(31)28-12-8-24(34)18-30(28)35/h5-12,17-18,26H,1-4,13-16,19-20H2/p+1/t26-,37?/m0/s1 |
| InChIKey | GSQSERCIJKDYBR-XVNGORCSSA-O |
| XLogP | 8.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.97 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|