C32H31Cl3FNO3 — CID 170170742
5-[4-[(1S)-4-chloro-1-fluoro-3-pyrrolidin-1-ylbutoxy]phenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 170170742) has the molecular formula C32H31Cl3FNO3 and a molecular weight of 602.96 g/mol. Its IUPAC name is 5-[4-[(1S)-4-chloro-1-fluoro-3-pyrrolidin-1-ylbutoxy]phenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 5-[4-[(1S)-4-chloro-1-fluoro-3-pyrrolidin-1-ylbutoxy]phenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 170170742 |
| Molecular Formula | C32H31Cl3FNO3 |
| Molecular Weight | 602.96 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | 5-[4-[(1S)-4-chloro-1-fluoro-3-pyrrolidin-1-ylbutoxy]phenyl]-6-(2,4-dichlorophenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(O[C@@H](F)CC(CCl)N2CCCC2)cc1 |
| InChI | InChI=1S/C32H31Cl3FNO3/c33-19-24(37-14-1-2-15-37)18-30(36)40-25-10-6-20(7-11-25)31-26-12-8-22(32(38)39)16-21(26)4-3-5-28(31)27-13-9-23(34)17-29(27)35/h6-13,16-17,24,30H,1-5,14-15,18-19H2,(H,38,39)/t24?,30-/m1/s1 |
| InChIKey | VOPLWRUMWXPFTL-BXFARTRRSA-N |
| XLogP | 8.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.96 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|