C15H21ClN4O2 — CID 169246390
4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)amino]bicyclo[2.2.1]heptan-1-ol (PubChem CID 169246390) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)amino]bicyclo[2.2.1]heptan-1-ol.
| Compound Name | 4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)amino]bicyclo[2.2.1]heptan-1-ol |
|---|---|
| PubChem CID | 169246390 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)amino]bicyclo[2.2.1]heptan-1-ol |
| SMILES | OC12CCC(Nc3nc(Cl)cc(N4CCOCC4)n3)(CC1)C2 |
| InChI | InChI=1S/C15H21ClN4O2/c16-11-9-12(20-5-7-22-8-6-20)18-13(17-11)19-14-1-3-15(21,10-14)4-2-14/h9,21H,1-8,10H2,(H,17,18,19) |
| InChIKey | SAXKGMMBPRBDBI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |