C19H30F3NO4 — CID 169263174
tert-butyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoate (PubChem CID 169263174) has the molecular formula C19H30F3NO4 and a molecular weight of 393.45 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoate.
| Compound Name | tert-butyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoate |
|---|---|
| PubChem CID | 169263174 |
| Molecular Formula | C19H30F3NO4 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoate |
| SMILES | C[C@@H](O)[C@H](NC(=O)/C=C/C=C/CCCCCC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30F3NO4/c1-14(24)16(17(26)27-18(2,3)4)23-15(25)12-10-8-6-5-7-9-11-13-19(20,21)22/h6,8,10,12,14,16,24H,5,7,9,11,13H2,1-4H3,(H,23,25)/b8-6+,12-10+/t14-,16+/m1/s1 |
| InChIKey | VXSRZNDMDMFUIJ-IEYZDVMISA-N |
| XLogP | 3.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|