C15H22F3NO4 — CID 169263196
(2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoic acid (PubChem CID 169263196) has the molecular formula C15H22F3NO4 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 169263196 |
| Molecular Formula | C15H22F3NO4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[(2E,4E)-11,11,11-trifluoroundeca-2,4-dienoyl]amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)/C=C/C=C/CCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H22F3NO4/c1-11(20)13(14(22)23)19-12(21)9-7-5-3-2-4-6-8-10-15(16,17)18/h3,5,7,9,11,13,20H,2,4,6,8,10H2,1H3,(H,19,21)(H,22,23)/b5-3+,9-7+/t11-,13+/m1/s1 |
| InChIKey | RPORJGOEVQYNDF-NVMXNZCOSA-N |
| XLogP | 2.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|