C23H33NO4 — CID 169263181
methyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoate (PubChem CID 169263181) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 169263181 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](NC(=O)/C=C/C=C/CCCCCC(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H33NO4/c1-18(2)14-10-7-5-4-6-8-13-17-20(25)24-21(23(27)28-3)22(26)19-15-11-9-12-16-19/h6,8-9,11-13,15-18,21-22,26H,4-5,7,10,14H2,1-3H3,(H,24,25)/b8-6+,17-13+/t21-,22+/m0/s1 |
| InChIKey | XJXSZJPVSOMAHI-KDIAQMTJSA-N |
| XLogP | 4.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|