C19H33NO4 — CID 169263220
(2S,3R)-3-hydroxy-4-methyl-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]pentanoic acid (PubChem CID 169263220) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-4-methyl-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]pentanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-4-methyl-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 169263220 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (2S,3R)-3-hydroxy-4-methyl-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]pentanoic acid |
| SMILES | CC(C)CCCCC/C=C/C=C/C(=O)N[C@H](C(=O)O)[C@H](O)C(C)C |
| InChI | InChI=1S/C19H33NO4/c1-14(2)12-10-8-6-5-7-9-11-13-16(21)20-17(19(23)24)18(22)15(3)4/h7,9,11,13-15,17-18,22H,5-6,8,10,12H2,1-4H3,(H,20,21)(H,23,24)/b9-7+,13-11+/t17-,18+/m0/s1 |
| InChIKey | XTYRLBOKUVNTLI-SGBMGGEDSA-N |
| XLogP | 3.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|