C22H31NO4 — CID 169263200
(2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoic acid (PubChem CID 169263200) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 169263200 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[(2E,4E)-11-methyldodeca-2,4-dienoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CCCCC/C=C/C=C/C(=O)N[C@H](C(=O)O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c1-17(2)13-9-6-4-3-5-7-12-16-19(24)23-20(22(26)27)21(25)18-14-10-8-11-15-18/h5,7-8,10-12,14-17,20-21,25H,3-4,6,9,13H2,1-2H3,(H,23,24)(H,26,27)/b7-5+,16-12+/t20-,21+/m0/s1 |
| InChIKey | IKTOEGGSZLSTCZ-HLLVXVCVSA-N |
| XLogP | 4.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|