C18H27NO4 — CID 54356743
(2S,3R)-3-hydroxy-2-(tetradeca-2,4,6,8-tetraenoylamino)butanoic acid (PubChem CID 54356743) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(tetradeca-2,4,6,8-tetraenoylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(tetradeca-2,4,6,8-tetraenoylamino)butanoic acid |
|---|---|
| PubChem CID | 54356743 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(tetradeca-2,4,6,8-tetraenoylamino)butanoic acid |
| SMILES | CCCCCC=CC=CC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C18H27NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(21)19-17(15(2)20)18(22)23/h7-15,17,20H,3-6H2,1-2H3,(H,19,21)(H,22,23)/t15-,17+/m1/s1 |
| InChIKey | UJPZCHAFFQYBKZ-WBVHZDCISA-N |
| XLogP | 2.74 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|