C26H27ClN6O3S — CID 169269557
6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)chromen-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 169269557) has the molecular formula C26H27ClN6O3S and a molecular weight of 539.06 g/mol. Its IUPAC name is 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)chromen-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)chromen-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269557 |
| Molecular Formula | C26H27ClN6O3S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)chromen-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1NC(C)c1cc(C)cc2c(=O)c(C)c(-c3cnn4c3CNCC4)oc12 |
| InChI | InChI=1S/C26H27ClN6O3S/c1-13-9-16(15(3)30-19-5-6-21(27)31-22(19)26(35)32-37-4)25-17(10-13)23(34)14(2)24(36-25)18-11-29-33-8-7-28-12-20(18)33/h5-6,9-11,15,28,30H,7-8,12H2,1-4H3,(H,32,35) |
| InChIKey | VKMJSRJSKSRKIN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|