C23H24ClN3O3S — CID 169270813
6-chloro-3-[[(1R)-1-(2-cyclopropyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 169270813) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-(2-cyclopropyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[[(1R)-1-(2-cyclopropyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169270813 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-(2-cyclopropyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1N[C@H](C)c1cc(C)cc2c(=O)c(C)c(C3CC3)oc12 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-11-9-15(22-16(10-11)20(28)12(2)21(30-22)14-5-6-14)13(3)25-17-7-8-18(24)26-19(17)23(29)27-31-4/h7-10,13-14,25H,5-6H2,1-4H3,(H,27,29)/t13-/m1/s1 |
| InChIKey | GOOPTMJJNGOAJW-CYBMUJFWSA-N |
| XLogP | 5.52 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|