C27H23FN4O — CID 169286565
2-[3-[(dimethylamino)methyl]phenyl]-3-(4-fluorophenyl)-N-prop-2-ynylquinoxaline-6-carboxamide (PubChem CID 169286565) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-[3-[(dimethylamino)methyl]phenyl]-3-(4-fluorophenyl)-N-prop-2-ynylquinoxaline-6-carboxamide.
| Compound Name | 2-[3-[(dimethylamino)methyl]phenyl]-3-(4-fluorophenyl)-N-prop-2-ynylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 169286565 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[3-[(dimethylamino)methyl]phenyl]-3-(4-fluorophenyl)-N-prop-2-ynylquinoxaline-6-carboxamide |
| SMILES | C#CCNC(=O)c1ccc2nc(-c3cccc(CN(C)C)c3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C27H23FN4O/c1-4-14-29-27(33)21-10-13-23-24(16-21)31-25(19-8-11-22(28)12-9-19)26(30-23)20-7-5-6-18(15-20)17-32(2)3/h1,5-13,15-16H,14,17H2,2-3H3,(H,29,33) |
| InChIKey | VXBLZVJQLOUDMP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|