C20H16F2O5 — CID 169306852
3-[4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methoxy]phenyl]hex-4-ynoic acid (PubChem CID 169306852) has the molecular formula C20H16F2O5 and a molecular weight of 374.34 g/mol. Its IUPAC name is 3-[4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 169306852 |
| Molecular Formula | C20H16F2O5 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[4-[(2,2-difluoro-1,3-benzodioxol-4-yl)methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2cccc3c2OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C20H16F2O5/c1-2-4-14(11-18(23)24)13-7-9-16(10-8-13)25-12-15-5-3-6-17-19(15)27-20(21,22)26-17/h3,5-10,14H,11-12H2,1H3,(H,23,24) |
| InChIKey | XZERXXLTJWHVAP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|