C30H40F3NO — CID 169312223
2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-3-(trifluoromethyl)pyridine (PubChem CID 169312223) has the molecular formula C30H40F3NO and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-3-(trifluoromethyl)pyridine.
| Compound Name | 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 169312223 |
| Molecular Formula | C30H40F3NO |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-3-(trifluoromethyl)pyridine |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)/C=C/c4ncccc4C(F)(F)F)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3CC132 |
| InChI | InChI=1S/C30H40F3NO/c1-18(7-10-25-24(30(31,32)33)6-5-15-34-25)21-8-9-22-20-16-26(35-4)29-17-19(29)11-14-28(29,3)23(20)12-13-27(21,22)2/h5-7,10,15,18-23,26H,8-9,11-14,16-17H2,1-4H3/b10-7+/t18-,19-,20+,21-,22+,23+,26?,27-,28-,29?/m1/s1 |
| InChIKey | QWYAVSXXVNJNBC-GSOVSTBASA-N |
| XLogP | 8.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |