C25H42N2O7 — CID 169316843
4-(2-methylpropoxymethyl)-N-[2-[2-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 169316843) has the molecular formula C25H42N2O7 and a molecular weight of 482.62 g/mol. Its IUPAC name is 4-(2-methylpropoxymethyl)-N-[2-[2-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-(2-methylpropoxymethyl)-N-[2-[2-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 169316843 |
| Molecular Formula | C25H42N2O7 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 4-(2-methylpropoxymethyl)-N-[2-[2-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CC(C)COCc1ccc(C(=O)NCCOCCOCCOCCNC(=O)COC(C)C)cc1 |
| InChI | InChI=1S/C25H42N2O7/c1-20(2)17-33-18-22-5-7-23(8-6-22)25(29)27-10-12-31-14-16-32-15-13-30-11-9-26-24(28)19-34-21(3)4/h5-8,20-21H,9-19H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | IHNZAQYHZQAYOB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|