C17H8Cl2F3NO3 — CID 169333710
5-[3,5-dichloro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde (PubChem CID 169333710) has the molecular formula C17H8Cl2F3NO3 and a molecular weight of 402.16 g/mol. Its IUPAC name is 5-[3,5-dichloro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3,5-dichloro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333710 |
| Molecular Formula | C17H8Cl2F3NO3 |
| Molecular Weight | 402.16 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 5-[3,5-dichloro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(Cl)c(Oc3cccc(C(F)(F)F)n3)c(Cl)c2)o1 |
| InChI | InChI=1S/C17H8Cl2F3NO3/c18-11-6-9(13-5-4-10(8-24)25-13)7-12(19)16(11)26-15-3-1-2-14(23-15)17(20,21)22/h1-8H |
| InChIKey | ZPASFDGGLYAPLY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.16 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|