About 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide
2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide (PubChem CID 169369012) has the molecular formula C12H14ClN3S
and a molecular weight of 267.79 g/mol. Its IUPAC name is 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide |
| PubChem CID | 169369012 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.79 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide |
| SMILES | CCCc1nc2ccc(/N=C(/N)CCl)cc2s1 |
| InChI | InChI=1S/C12H14ClN3S/c1-2-3-12-16-9-5-4-8(6-10(9)17-12)15-11(14)7-13/h4-6H,2-3,7H2,1H3,(H2,14,15) |
| InChIKey | QQMLIJHKDBXVHY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide?
The IUPAC name of 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide (CID 169369012) is 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide.
What is the SMILES notation for 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide?
The canonical SMILES for 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide is CCCc1nc2ccc(/N=C(/N)CCl)cc2s1.
What is the InChIKey of 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide?
The InChIKey is QQMLIJHKDBXVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3S/c1-2-3-12-16-9-5-4-8(6-10(9)17-12)15-11(14)7-13/h4-6H,2-3,7H2,1H3,(H2,14,15).
What are the key properties of 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide?
2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide has a molecular weight of 267.79 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(2-propyl-1,3-benzothiazol-6-yl)ethanimidamide is sourced from PubChem (CID 169369012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).