C18H20FNO4S — CID 169372450
N-[2-fluoro-6-(oxolan-2-ylmethoxy)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169372450) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[2-fluoro-6-(oxolan-2-ylmethoxy)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-fluoro-6-(oxolan-2-ylmethoxy)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169372450 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-fluoro-6-(oxolan-2-ylmethoxy)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(F)cccc2OCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H20FNO4S/c1-13-7-9-15(10-8-13)25(21,22)20-18-16(19)5-2-6-17(18)24-12-14-4-3-11-23-14/h2,5-10,14,20H,3-4,11-12H2,1H3 |
| InChIKey | ZZPJNJPMFSAWFS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |