C25H30N10O2 — CID 169381120
tert-butyl 4-[[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 169381120) has the molecular formula C25H30N10O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is tert-butyl 4-[[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169381120 |
| Molecular Formula | C25H30N10O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | tert-butyl 4-[[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(C3N=C(NC#N)Nc4nc(N)c(C#N)c(N)c43)cc2)CC1 |
| InChI | InChI=1S/C25H30N10O2/c1-25(2,3)37-24(36)35-10-8-34(9-11-35)13-15-4-6-16(7-5-15)20-18-19(28)17(12-26)21(29)32-22(18)33-23(31-20)30-14-27/h4-7,20H,8-11,13H2,1-3H3,(H6,28,29,30,31,32,33) |
| InChIKey | AVXHUUSXDLFYKZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 181.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|