C19H20F3N3O3 — CID 169383993
tert-butyl N-[2-[(phenylhydrazinylidene)methyl]-4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 169383993) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is tert-butyl N-[2-[(phenylhydrazinylidene)methyl]-4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(phenylhydrazinylidene)methyl]-4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 169383993 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl N-[2-[(phenylhydrazinylidene)methyl]-4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OC(F)(F)F)cc1C=NNc1ccccc1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-18(2,3)28-17(26)24-16-10-9-15(27-19(20,21)22)11-13(16)12-23-25-14-7-5-4-6-8-14/h4-12,25H,1-3H3,(H,24,26) |
| InChIKey | FIKBALCXOCJIGM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|