C12H18N2O4S — CID 169430819
4-methylbenzenesulfonate;[(3R)-1-methyl-2-oxopyrrolidin-3-yl]azanium (PubChem CID 169430819) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;[(3R)-1-methyl-2-oxopyrrolidin-3-yl]azanium.
| Compound Name | 4-methylbenzenesulfonate;[(3R)-1-methyl-2-oxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 169430819 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-methylbenzenesulfonate;[(3R)-1-methyl-2-oxopyrrolidin-3-yl]azanium |
| SMILES | CN1CC[C@@H]([NH3+])C1=O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H10N2O/c1-6-2-4-7(5-3-6)11(8,9)10;1-7-3-2-4(6)5(7)8/h2-5H,1H3,(H,8,9,10);4H,2-3,6H2,1H3/t;4-/m.1/s1 |
| InChIKey | KLOWILKBDXTWES-FZSMXKCYSA-N |
| XLogP | -0.64 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|