C15H25N5 — CID 169433103
5-ethyl-6-octyl-(3,5-13C2,1,2-15N2)[1,2,4]triazolo[1,5-a](213C,115N)pyrimidin-7-amine (PubChem CID 169433103) has the molecular formula C15H25N5 and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-ethyl-6-octyl-(3,5-13C2,1,2-15N2)[1,2,4]triazolo[1,5-a](213C,115N)pyrimidin-7-amine.
| Compound Name | 5-ethyl-6-octyl-(3,5-13C2,1,2-15N2)[1,2,4]triazolo[1,5-a](213C,115N)pyrimidin-7-amine |
|---|---|
| PubChem CID | 169433103 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 5-ethyl-6-octyl-(3,5-13C2,1,2-15N2)[1,2,4]triazolo[1,5-a](213C,115N)pyrimidin-7-amine |
| SMILES | CCCCCCCCc1c(CC)n[13c]2n[13cH][15n][15n]2c1N |
| InChI | InChI=1S/C15H25N5/c1-3-5-6-7-8-9-10-12-13(4-2)19-15-17-11-18-20(15)14(12)16/h11H,3-10,16H2,1-2H3/i11+1,15+1,18+1,20+1 |
| InChIKey | GGKQIOFASHYUJZ-LAFGIURGSA-N |
| XLogP | 3.17 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|