C16H27N5 — CID 69499706
6-octyl-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 69499706) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 6-octyl-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-octyl-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69499706 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 6-octyl-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCCCCc1c(C(C)C)nc2ncnn2c1N |
| InChI | InChI=1S/C16H27N5/c1-4-5-6-7-8-9-10-13-14(12(2)3)20-16-18-11-19-21(16)15(13)17/h11-12H,4-10,17H2,1-3H3 |
| InChIKey | LSXDTTSLNXADOD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|