C6H14N2O2 — CID 169437485
N-(1,2,3-13C3)propan-2-yl-N-propan-2-ylnitramide (PubChem CID 169437485) has the molecular formula C6H14N2O2 and a molecular weight of 149.17 g/mol. Its IUPAC name is N-(1,2,3-13C3)propan-2-yl-N-propan-2-ylnitramide.
| Compound Name | N-(1,2,3-13C3)propan-2-yl-N-propan-2-ylnitramide |
|---|---|
| PubChem CID | 169437485 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-(1,2,3-13C3)propan-2-yl-N-propan-2-ylnitramide |
| SMILES | CC(C)N([13CH]([13CH3])[13CH3])[N+](=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c1-5(2)7(6(3)4)8(9)10/h5-6H,1-4H3/i1+1,2+1,5+1 |
| InChIKey | NNTWPXAZILBWAG-NLQHJZJRSA-N |
| XLogP | 1.30 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|