C17H27NO3 — CID 169447665
2-(3,3,4,4,5,5-hexadeuterio-1-hydroxycyclohexyl)-2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide (PubChem CID 169447665) has the molecular formula C17H27NO3 and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexadeuterio-1-hydroxycyclohexyl)-2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide.
| Compound Name | 2-(3,3,4,4,5,5-hexadeuterio-1-hydroxycyclohexyl)-2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 169447665 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexadeuterio-1-hydroxycyclohexyl)-2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide |
| SMILES | [2H]C1([2H])CC(O)(C(C[N+](C)(C)[O-])c2ccc(OC)cc2)CC([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C17H27NO3/c1-18(2,20)13-16(17(19)11-5-4-6-12-17)14-7-9-15(21-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3/i4D2,5D2,6D2 |
| InChIKey | LASJEFFANGIOGZ-KETLRHEYSA-N |
| XLogP | 3.05 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|