C12H13NO — CID 169452057
2-ethynyl-N,N,3-trimethylbenzamide (PubChem CID 169452057) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-ethynyl-N,N,3-trimethylbenzamide.
| Compound Name | 2-ethynyl-N,N,3-trimethylbenzamide |
|---|---|
| PubChem CID | 169452057 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-ethynyl-N,N,3-trimethylbenzamide |
| SMILES | C#Cc1c(C)cccc1C(=O)N(C)C |
| InChI | InChI=1S/C12H13NO/c1-5-10-9(2)7-6-8-11(10)12(14)13(3)4/h1,6-8H,2-4H3 |
| InChIKey | NGWUGIJGFZLGBD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|