C6H6BrNS2 — CID 169456473
3-(2-bromo-1,3-thiazol-4-yl)prop-2-ene-1-thiol (PubChem CID 169456473) has the molecular formula C6H6BrNS2 and a molecular weight of 236.16 g/mol. Its IUPAC name is 3-(2-bromo-1,3-thiazol-4-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(2-bromo-1,3-thiazol-4-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169456473 |
| Molecular Formula | C6H6BrNS2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 234.91 |
| IUPAC Name | 3-(2-bromo-1,3-thiazol-4-yl)prop-2-ene-1-thiol |
| SMILES | SCC=Cc1csc(Br)n1 |
| InChI | InChI=1S/C6H6BrNS2/c7-6-8-5(4-10-6)2-1-3-9/h1-2,4,9H,3H2 |
| InChIKey | GRYRDYSNRWKLCA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|